C17H28N4 — CID 66209789
5-[(1-cyclohexylpyrazol-3-yl)methyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 66209789) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 5-[(1-cyclohexylpyrazol-3-yl)methyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[(1-cyclohexylpyrazol-3-yl)methyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66209789 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 5-[(1-cyclohexylpyrazol-3-yl)methyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CC1C2CNCC2CN1Cc1ccn(C2CCCCC2)n1 |
| InChI | InChI=1S/C17H28N4/c1-13-17-10-18-9-14(17)11-20(13)12-15-7-8-21(19-15)16-5-3-2-4-6-16/h7-8,13-14,16-18H,2-6,9-12H2,1H3 |
| InChIKey | PRCBEJDVLMSREN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |