C16H26BrN3O — CID 81212721
2-(bromomethyl)-4-[(1-cyclohexylpyrazol-3-yl)methyl]-5-methylmorpholine (PubChem CID 81212721) has the molecular formula C16H26BrN3O and a molecular weight of 356.31 g/mol. Its IUPAC name is 2-(bromomethyl)-4-[(1-cyclohexylpyrazol-3-yl)methyl]-5-methylmorpholine.
| Compound Name | 2-(bromomethyl)-4-[(1-cyclohexylpyrazol-3-yl)methyl]-5-methylmorpholine |
|---|---|
| PubChem CID | 81212721 |
| Molecular Formula | C16H26BrN3O |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-(bromomethyl)-4-[(1-cyclohexylpyrazol-3-yl)methyl]-5-methylmorpholine |
| SMILES | CC1COC(CBr)CN1Cc1ccn(C2CCCCC2)n1 |
| InChI | InChI=1S/C16H26BrN3O/c1-13-12-21-16(9-17)11-19(13)10-14-7-8-20(18-14)15-5-3-2-4-6-15/h7-8,13,15-16H,2-6,9-12H2,1H3 |
| InChIKey | HKHNGBSTAHRIBS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|