C16H21BrN2O — CID 66210056
2-(3-bromophenyl)-1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethanone (PubChem CID 66210056) has the molecular formula C16H21BrN2O and a molecular weight of 337.26 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethanone.
| Compound Name | 2-(3-bromophenyl)-1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethanone |
|---|---|
| PubChem CID | 66210056 |
| Molecular Formula | C16H21BrN2O |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-(3-bromophenyl)-1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethanone |
| SMILES | CCC1C2CNCC2CN1C(=O)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C16H21BrN2O/c1-2-15-14-9-18-8-12(14)10-19(15)16(20)7-11-4-3-5-13(17)6-11/h3-6,12,14-15,18H,2,7-10H2,1H3 |
| InChIKey | VAKJSJGBNXJVTA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |