C13H16IN3O3 — CID 66211551
8-N-(2-iodo-4-nitrophenyl)-2-oxabicyclo[4.2.0]octane-7,8-diamine (PubChem CID 66211551) has the molecular formula C13H16IN3O3 and a molecular weight of 389.19 g/mol. Its IUPAC name is 8-N-(2-iodo-4-nitrophenyl)-2-oxabicyclo[4.2.0]octane-7,8-diamine.
| Compound Name | 8-N-(2-iodo-4-nitrophenyl)-2-oxabicyclo[4.2.0]octane-7,8-diamine |
|---|---|
| PubChem CID | 66211551 |
| Molecular Formula | C13H16IN3O3 |
| Molecular Weight | 389.19 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 8-N-(2-iodo-4-nitrophenyl)-2-oxabicyclo[4.2.0]octane-7,8-diamine |
| SMILES | NC1C2CCCOC2C1Nc1ccc([N+](=O)[O-])cc1I |
| InChI | InChI=1S/C13H16IN3O3/c14-9-6-7(17(18)19)3-4-10(9)16-12-11(15)8-2-1-5-20-13(8)12/h3-4,6,8,11-13,16H,1-2,5,15H2 |
| InChIKey | DTOXVJYDCSXMKU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|