C10H22N2OS — CID 66219204
2-(2-aminopropylsulfanyl)-N,N-diethylpropanamide (PubChem CID 66219204) has the molecular formula C10H22N2OS and a molecular weight of 218.37 g/mol. Its IUPAC name is 2-(2-aminopropylsulfanyl)-N,N-diethylpropanamide.
| Compound Name | 2-(2-aminopropylsulfanyl)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 66219204 |
| Molecular Formula | C10H22N2OS |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-(2-aminopropylsulfanyl)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)SCC(C)N |
| InChI | InChI=1S/C10H22N2OS/c1-5-12(6-2)10(13)9(4)14-7-8(3)11/h8-9H,5-7,11H2,1-4H3 |
| InChIKey | YNRZZTKQRMLTJR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |