C10H21NO2S — CID 66128071
N,N-diethyl-2-(3-hydroxypropylsulfanyl)propanamide (PubChem CID 66128071) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is N,N-diethyl-2-(3-hydroxypropylsulfanyl)propanamide.
| Compound Name | N,N-diethyl-2-(3-hydroxypropylsulfanyl)propanamide |
|---|---|
| PubChem CID | 66128071 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N,N-diethyl-2-(3-hydroxypropylsulfanyl)propanamide |
| SMILES | CCN(CC)C(=O)C(C)SCCCO |
| InChI | InChI=1S/C10H21NO2S/c1-4-11(5-2)10(13)9(3)14-8-6-7-12/h9,12H,4-8H2,1-3H3 |
| InChIKey | ORMZIKCZGVJRPZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|