C9H15ClN2O2 — CID 66221287
4-chloro-1-(2,2-dimethoxyethyl)-3,5-dimethylpyrazole (PubChem CID 66221287) has the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. Its IUPAC name is 4-chloro-1-(2,2-dimethoxyethyl)-3,5-dimethylpyrazole.
| Compound Name | 4-chloro-1-(2,2-dimethoxyethyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 66221287 |
| Molecular Formula | C9H15ClN2O2 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 4-chloro-1-(2,2-dimethoxyethyl)-3,5-dimethylpyrazole |
| SMILES | COC(Cn1nc(C)c(Cl)c1C)OC |
| InChI | InChI=1S/C9H15ClN2O2/c1-6-9(10)7(2)12(11-6)5-8(13-3)14-4/h8H,5H2,1-4H3 |
| InChIKey | YCUBCPMJBBEPOX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|