C12H23NS — CID 66224673
2-cycloheptyl-6-methyl-1,3-thiazinane (PubChem CID 66224673) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is 2-cycloheptyl-6-methyl-1,3-thiazinane.
| Compound Name | 2-cycloheptyl-6-methyl-1,3-thiazinane |
|---|---|
| PubChem CID | 66224673 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 2-cycloheptyl-6-methyl-1,3-thiazinane |
| SMILES | CC1CCNC(C2CCCCCC2)S1 |
| InChI | InChI=1S/C12H23NS/c1-10-8-9-13-12(14-10)11-6-4-2-3-5-7-11/h10-13H,2-9H2,1H3 |
| InChIKey | FDHLKJGFGWQSGK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |