C13H16N2OS — CID 66228197
3-(5-ethyl-1-oxo-1,4-thiazinan-3-yl)benzonitrile (PubChem CID 66228197) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 3-(5-ethyl-1-oxo-1,4-thiazinan-3-yl)benzonitrile.
| Compound Name | 3-(5-ethyl-1-oxo-1,4-thiazinan-3-yl)benzonitrile |
|---|---|
| PubChem CID | 66228197 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-(5-ethyl-1-oxo-1,4-thiazinan-3-yl)benzonitrile |
| SMILES | CCC1CS(=O)CC(c2cccc(C#N)c2)N1 |
| InChI | InChI=1S/C13H16N2OS/c1-2-12-8-17(16)9-13(15-12)11-5-3-4-10(6-11)7-14/h3-6,12-13,15H,2,8-9H2,1H3 |
| InChIKey | FWPPSABADKXWPS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |