C10H8N2O2 — CID 130943305
3-(2-oxo-1,3-oxazolidin-4-yl)benzonitrile (PubChem CID 130943305) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is 3-(2-oxo-1,3-oxazolidin-4-yl)benzonitrile.
| Compound Name | 3-(2-oxo-1,3-oxazolidin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 130943305 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 3-(2-oxo-1,3-oxazolidin-4-yl)benzonitrile |
| SMILES | N#Cc1cccc(C2COC(=O)N2)c1 |
| InChI | InChI=1S/C10H8N2O2/c11-5-7-2-1-3-8(4-7)9-6-14-10(13)12-9/h1-4,9H,6H2,(H,12,13) |
| InChIKey | BPXFPTZOSXWGEI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |