C11H17NO2S2 — CID 66229474
2,5,5-trimethyl-3-thiophen-2-yl-1,4-thiazinane 1,1-dioxide (PubChem CID 66229474) has the molecular formula C11H17NO2S2 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2,5,5-trimethyl-3-thiophen-2-yl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 2,5,5-trimethyl-3-thiophen-2-yl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 66229474 |
| Molecular Formula | C11H17NO2S2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2,5,5-trimethyl-3-thiophen-2-yl-1,4-thiazinane 1,1-dioxide |
| SMILES | CC1C(c2cccs2)NC(C)(C)CS1(=O)=O |
| InChI | InChI=1S/C11H17NO2S2/c1-8-10(9-5-4-6-15-9)12-11(2,3)7-16(8,13)14/h4-6,8,10,12H,7H2,1-3H3 |
| InChIKey | XLKCJPYKCVEUCE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |