C15H23NO2S — CID 66230082
3-ethyl-5-(2,4,6-trimethylphenyl)-1,4-thiazinane 1,1-dioxide (PubChem CID 66230082) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 3-ethyl-5-(2,4,6-trimethylphenyl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 3-ethyl-5-(2,4,6-trimethylphenyl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 66230082 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-ethyl-5-(2,4,6-trimethylphenyl)-1,4-thiazinane 1,1-dioxide |
| SMILES | CCC1CS(=O)(=O)CC(c2c(C)cc(C)cc2C)N1 |
| InChI | InChI=1S/C15H23NO2S/c1-5-13-8-19(17,18)9-14(16-13)15-11(3)6-10(2)7-12(15)4/h6-7,13-14,16H,5,8-9H2,1-4H3 |
| InChIKey | FKRZHIWLXKIKIZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |