C13H20N2O — CID 77099139
[5-(2,4,6-trimethylphenyl)pyrazolidin-3-yl]methanol (PubChem CID 77099139) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is [5-(2,4,6-trimethylphenyl)pyrazolidin-3-yl]methanol.
| Compound Name | [5-(2,4,6-trimethylphenyl)pyrazolidin-3-yl]methanol |
|---|---|
| PubChem CID | 77099139 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | [5-(2,4,6-trimethylphenyl)pyrazolidin-3-yl]methanol |
| SMILES | Cc1cc(C)c(C2CC(CO)NN2)c(C)c1 |
| InChI | InChI=1S/C13H20N2O/c1-8-4-9(2)13(10(3)5-8)12-6-11(7-16)14-15-12/h4-5,11-12,14-16H,6-7H2,1-3H3 |
| InChIKey | FTCPQDKJNZYFMB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |