About 4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine
4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine (PubChem CID 66230286) has the molecular formula C14H20N2S
and a molecular weight of 248.39 g/mol. Its IUPAC name is 4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine |
| PubChem CID | 66230286 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine |
| SMILES | CCC1CSC(c2ccc3c(c2)CCN3C)N1 |
| InChI | InChI=1S/C14H20N2S/c1-3-12-9-17-14(15-12)11-4-5-13-10(8-11)6-7-16(13)2/h4-5,8,12,14-15H,3,6-7,9H2,1-2H3 |
| InChIKey | JLLSCNUAKJSEQC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine?
The IUPAC name of 4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine (CID 66230286) is 4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine.
What is the SMILES notation for 4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine?
The canonical SMILES for 4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine is CCC1CSC(c2ccc3c(c2)CCN3C)N1.
What is the InChIKey of 4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine?
The InChIKey is JLLSCNUAKJSEQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2S/c1-3-12-9-17-14(15-12)11-4-5-13-10(8-11)6-7-16(13)2/h4-5,8,12,14-15H,3,6-7,9H2,1-2H3.
What are the key properties of 4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine?
4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine has a molecular weight of 248.39 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-(1-methyl-2,3-dihydroindol-5-yl)-1,3-thiazolidine is sourced from PubChem (CID 66230286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).