C15H22N2S — CID 66227743
5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazinane (PubChem CID 66227743) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazinane.
| Compound Name | 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazinane |
|---|---|
| PubChem CID | 66227743 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazinane |
| SMILES | CC1CNC(c2ccc3c(c2)CCCN3C)SC1 |
| InChI | InChI=1S/C15H22N2S/c1-11-9-16-15(18-10-11)13-5-6-14-12(8-13)4-3-7-17(14)2/h5-6,8,11,15-16H,3-4,7,9-10H2,1-2H3 |
| InChIKey | LZWLEOHKXYKIIU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|