C12H15F2NOS — CID 66233100
2-[2-(difluoromethoxy)phenyl]-4-methyl-1,3-thiazinane (PubChem CID 66233100) has the molecular formula C12H15F2NOS and a molecular weight of 259.32 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)phenyl]-4-methyl-1,3-thiazinane.
| Compound Name | 2-[2-(difluoromethoxy)phenyl]-4-methyl-1,3-thiazinane |
|---|---|
| PubChem CID | 66233100 |
| Molecular Formula | C12H15F2NOS |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-[2-(difluoromethoxy)phenyl]-4-methyl-1,3-thiazinane |
| SMILES | CC1CCSC(c2ccccc2OC(F)F)N1 |
| InChI | InChI=1S/C12H15F2NOS/c1-8-6-7-17-11(15-8)9-4-2-3-5-10(9)16-12(13)14/h2-5,8,11-12,15H,6-7H2,1H3 |
| InChIKey | BVQAZPLRLMCSJK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |