C9H13NS2 — CID 66231741
4-methyl-2-thiophen-2-yl-1,3-thiazinane (PubChem CID 66231741) has the molecular formula C9H13NS2 and a molecular weight of 199.34 g/mol. Its IUPAC name is 4-methyl-2-thiophen-2-yl-1,3-thiazinane.
| Compound Name | 4-methyl-2-thiophen-2-yl-1,3-thiazinane |
|---|---|
| PubChem CID | 66231741 |
| Molecular Formula | C9H13NS2 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 4-methyl-2-thiophen-2-yl-1,3-thiazinane |
| SMILES | CC1CCSC(c2cccs2)N1 |
| InChI | InChI=1S/C9H13NS2/c1-7-4-6-12-9(10-7)8-3-2-5-11-8/h2-3,5,7,9-10H,4,6H2,1H3 |
| InChIKey | HGXADCKSDJVTJA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |