4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid

C8H13NO5S — CID 66240870

IUPAC4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid
SMILESO=C(O)C1COCC1N1CCCS1(=O)=O
InChIInChI=1S/C8H13NO5S/c10-8(11)6-4-14-5-7(6)9-2-1-3-15(9,12)13/h6-7H,1-5H2,(H,10,11)
InChIKeyJXSLHIPCAIAUBH-UHFFFAOYSA-N
MW235.26 g/mol
LogP-0.88
Rot. Bonds2

About 4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid

4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid (PubChem CID 66240870) has the molecular formula C8H13NO5S and a molecular weight of 235.26 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid.

Molecular Properties

Compound Name4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid
PubChem CID66240870
Molecular FormulaC8H13NO5S
Molecular Weight235.26 g/mol
Exact Mass235.05
IUPAC Name4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid
SMILESO=C(O)C1COCC1N1CCCS1(=O)=O
InChIInChI=1S/C8H13NO5S/c10-8(11)6-4-14-5-7(6)9-2-1-3-15(9,12)13/h6-7H,1-5H2,(H,10,11)
InChIKeyJXSLHIPCAIAUBH-UHFFFAOYSA-N
XLogP-0.88
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.26
LogP ≤ 5-0.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid?
The IUPAC name of 4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid (CID 66240870) is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid.
What is the SMILES notation for 4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid?
The canonical SMILES for 4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid is O=C(O)C1COCC1N1CCCS1(=O)=O.
What is the InChIKey of 4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid?
The InChIKey is JXSLHIPCAIAUBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO5S/c10-8(11)6-4-14-5-7(6)9-2-1-3-15(9,12)13/h6-7H,1-5H2,(H,10,11).
What are the key properties of 4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid?
4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid has a molecular weight of 235.26 g/mol, XLogP of -0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxo-1,2-thiazolidin-2-yl)oxolane-3-carboxylic acid is sourced from PubChem (CID 66240870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).