C10H17NO4S — CID 83825294
2-(1,1-dioxothiazinan-2-yl)cyclopentane-1-carboxylic acid (PubChem CID 83825294) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-(1,1-dioxothiazinan-2-yl)cyclopentane-1-carboxylic acid.
| Compound Name | 2-(1,1-dioxothiazinan-2-yl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 83825294 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-(1,1-dioxothiazinan-2-yl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C10H17NO4S/c12-10(13)8-4-3-5-9(8)11-6-1-2-7-16(11,14)15/h8-9H,1-7H2,(H,12,13) |
| InChIKey | RYZYBCUZYDRHFK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |