C11H13Cl2NO2S — CID 66241664
5-(2,4-dichlorophenyl)-2-methyl-1,4-thiazinane 1,1-dioxide (PubChem CID 66241664) has the molecular formula C11H13Cl2NO2S and a molecular weight of 294.20 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-2-methyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 5-(2,4-dichlorophenyl)-2-methyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 66241664 |
| Molecular Formula | C11H13Cl2NO2S |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-2-methyl-1,4-thiazinane 1,1-dioxide |
| SMILES | CC1CNC(c2ccc(Cl)cc2Cl)CS1(=O)=O |
| InChI | InChI=1S/C11H13Cl2NO2S/c1-7-5-14-11(6-17(7,15)16)9-3-2-8(12)4-10(9)13/h2-4,7,11,14H,5-6H2,1H3 |
| InChIKey | BWSMJVSCLQOTAJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |