C11H12ClNO2S — CID 66243272
2-(7-chloro-1,3-benzodioxol-5-yl)-5-methyl-1,3-thiazolidine (PubChem CID 66243272) has the molecular formula C11H12ClNO2S and a molecular weight of 257.74 g/mol. Its IUPAC name is 2-(7-chloro-1,3-benzodioxol-5-yl)-5-methyl-1,3-thiazolidine.
| Compound Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-5-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 66243272 |
| Molecular Formula | C11H12ClNO2S |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-5-methyl-1,3-thiazolidine |
| SMILES | CC1CNC(c2cc(Cl)c3c(c2)OCO3)S1 |
| InChI | InChI=1S/C11H12ClNO2S/c1-6-4-13-11(16-6)7-2-8(12)10-9(3-7)14-5-15-10/h2-3,6,11,13H,4-5H2,1H3 |
| InChIKey | NGZQFQQWTNBDNB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |