C13H19NO3S — CID 66247933
2-thiophen-2-ylethyl 4-(ethylamino)oxolane-3-carboxylate (PubChem CID 66247933) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 4-(ethylamino)oxolane-3-carboxylate.
| Compound Name | 2-thiophen-2-ylethyl 4-(ethylamino)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 66247933 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-thiophen-2-ylethyl 4-(ethylamino)oxolane-3-carboxylate |
| SMILES | CCNC1COCC1C(=O)OCCc1cccs1 |
| InChI | InChI=1S/C13H19NO3S/c1-2-14-12-9-16-8-11(12)13(15)17-6-5-10-4-3-7-18-10/h3-4,7,11-12,14H,2,5-6,8-9H2,1H3 |
| InChIKey | ZKZAOEMMARXOHK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |