C10H12N4O3S — CID 66247993
5-nitro-6-[(3S)-piperidin-3-yl]oxyimidazo[2,1-b][1,3]thiazole (PubChem CID 66247993) has the molecular formula C10H12N4O3S and a molecular weight of 268.30 g/mol. Its IUPAC name is 5-nitro-6-[(3S)-piperidin-3-yl]oxyimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-nitro-6-[(3S)-piperidin-3-yl]oxyimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 66247993 |
| Molecular Formula | C10H12N4O3S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 5-nitro-6-[(3S)-piperidin-3-yl]oxyimidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1c(O[C@H]2CCCNC2)nc2sccn12 |
| InChI | InChI=1S/C10H12N4O3S/c15-14(16)9-8(12-10-13(9)4-5-18-10)17-7-2-1-3-11-6-7/h4-5,7,11H,1-3,6H2/t7-/m0/s1 |
| InChIKey | GSKGLPXRIRPESL-ZETCQYMHSA-N |
| XLogP | 1.43 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|