C12H10BFN4O3 — CID 66274109
[2-fluoro-5-[(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)methyl]phenyl]boronic acid (PubChem CID 66274109) has the molecular formula C12H10BFN4O3 and a molecular weight of 288.05 g/mol. Its IUPAC name is [2-fluoro-5-[(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)methyl]phenyl]boronic acid.
| Compound Name | [2-fluoro-5-[(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 66274109 |
| Molecular Formula | C12H10BFN4O3 |
| Molecular Weight | 288.05 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | [2-fluoro-5-[(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)methyl]phenyl]boronic acid |
| SMILES | O=c1n(Cc2ccc(F)c(B(O)O)c2)nc2cnccn12 |
| InChI | InChI=1S/C12H10BFN4O3/c14-10-2-1-8(5-9(10)13(20)21)7-18-12(19)17-4-3-15-6-11(17)16-18/h1-6,20-21H,7H2 |
| InChIKey | FSSNSYDRNCNVSC-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.05 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|