About 3-N-ethyl-3-N-methyl-1H-1,2,4-triazole-3,5-diamine
3-N-ethyl-3-N-methyl-1H-1,2,4-triazole-3,5-diamine (PubChem CID 66277105) has the molecular formula C5H11N5
and a molecular weight of 141.18 g/mol. Its IUPAC name is 3-N-ethyl-3-N-methyl-1H-1,2,4-triazole-3,5-diamine.
Analyze 3-N-ethyl-3-N-methyl-1H-1,2,4-triazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-ethyl-3-N-methyl-1H-1,2,4-triazole-3,5-diamine?
The IUPAC name of 3-N-ethyl-3-N-methyl-1H-1,2,4-triazole-3,5-diamine (CID 66277105) is 3-N-ethyl-3-N-methyl-1H-1,2,4-triazole-3,5-diamine.
What is the SMILES notation for 3-N-ethyl-3-N-methyl-1H-1,2,4-triazole-3,5-diamine?
The canonical SMILES for 3-N-ethyl-3-N-methyl-1H-1,2,4-triazole-3,5-diamine is CCN(C)c1n[nH]c(N)n1.
What is the InChIKey of 3-N-ethyl-3-N-methyl-1H-1,2,4-triazole-3,5-diamine?
The InChIKey is CUFNUUWFPDMDEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N5/c1-3-10(2)5-7-4(6)8-9-5/h3H2,1-2H3,(H3,6,7,8,9).
What are the key properties of 3-N-ethyl-3-N-methyl-1H-1,2,4-triazole-3,5-diamine?
3-N-ethyl-3-N-methyl-1H-1,2,4-triazole-3,5-diamine has a molecular weight of 141.18 g/mol, XLogP of -0.16, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-ethyl-3-N-methyl-1H-1,2,4-triazole-3,5-diamine is sourced from PubChem (CID 66277105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).