C13H11F2N3O3 — CID 66287105
methyl 4-(4-amino-2,5-difluorophenoxy)-6-methylpyrimidine-2-carboxylate (PubChem CID 66287105) has the molecular formula C13H11F2N3O3 and a molecular weight of 295.25 g/mol. Its IUPAC name is methyl 4-(4-amino-2,5-difluorophenoxy)-6-methylpyrimidine-2-carboxylate.
| Compound Name | methyl 4-(4-amino-2,5-difluorophenoxy)-6-methylpyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 66287105 |
| Molecular Formula | C13H11F2N3O3 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | methyl 4-(4-amino-2,5-difluorophenoxy)-6-methylpyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc(C)cc(Oc2cc(F)c(N)cc2F)n1 |
| InChI | InChI=1S/C13H11F2N3O3/c1-6-3-11(18-12(17-6)13(19)20-2)21-10-5-7(14)9(16)4-8(10)15/h3-5H,16H2,1-2H3 |
| InChIKey | YVUKGRLUFRHWBH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|