C10H11ClF3IN2 — CID 66292573
4-tert-butyl-6-chloro-5-iodo-2-(2,2,2-trifluoroethyl)pyrimidine (PubChem CID 66292573) has the molecular formula C10H11ClF3IN2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 4-tert-butyl-6-chloro-5-iodo-2-(2,2,2-trifluoroethyl)pyrimidine.
| Compound Name | 4-tert-butyl-6-chloro-5-iodo-2-(2,2,2-trifluoroethyl)pyrimidine |
|---|---|
| PubChem CID | 66292573 |
| Molecular Formula | C10H11ClF3IN2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | 4-tert-butyl-6-chloro-5-iodo-2-(2,2,2-trifluoroethyl)pyrimidine |
| SMILES | CC(C)(C)c1nc(CC(F)(F)F)nc(Cl)c1I |
| InChI | InChI=1S/C10H11ClF3IN2/c1-9(2,3)7-6(15)8(11)17-5(16-7)4-10(12,13)14/h4H2,1-3H3 |
| InChIKey | PDLUVBPHODLWDT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|