C8H7ClF3IN2O — CID 66293865
4-chloro-5-iodo-6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidine (PubChem CID 66293865) has the molecular formula C8H7ClF3IN2O and a molecular weight of 366.51 g/mol. Its IUPAC name is 4-chloro-5-iodo-6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidine.
| Compound Name | 4-chloro-5-iodo-6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidine |
|---|---|
| PubChem CID | 66293865 |
| Molecular Formula | C8H7ClF3IN2O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 365.92 |
| IUPAC Name | 4-chloro-5-iodo-6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidine |
| SMILES | COCc1nc(CC(F)(F)F)nc(Cl)c1I |
| InChI | InChI=1S/C8H7ClF3IN2O/c1-16-3-4-6(13)7(9)15-5(14-4)2-8(10,11)12/h2-3H2,1H3 |
| InChIKey | MNLDIVKVTPQMDO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|