C16H16ClIN2 — CID 66294437
4-chloro-6-ethyl-5-iodo-2-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidine (PubChem CID 66294437) has the molecular formula C16H16ClIN2 and a molecular weight of 398.68 g/mol. Its IUPAC name is 4-chloro-6-ethyl-5-iodo-2-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidine.
| Compound Name | 4-chloro-6-ethyl-5-iodo-2-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidine |
|---|---|
| PubChem CID | 66294437 |
| Molecular Formula | C16H16ClIN2 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 4-chloro-6-ethyl-5-iodo-2-(1,2,3,4-tetrahydronaphthalen-2-yl)pyrimidine |
| SMILES | CCc1nc(C2CCc3ccccc3C2)nc(Cl)c1I |
| InChI | InChI=1S/C16H16ClIN2/c1-2-13-14(18)15(17)20-16(19-13)12-8-7-10-5-3-4-6-11(10)9-12/h3-6,12H,2,7-9H2,1H3 |
| InChIKey | IIWSFLBYMINKHO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|