C15H16BrN3 — CID 66299040
5-bromo-2-(2,3-dihydro-1H-inden-2-yl)-6-ethylpyrimidin-4-amine (PubChem CID 66299040) has the molecular formula C15H16BrN3 and a molecular weight of 318.22 g/mol. Its IUPAC name is 5-bromo-2-(2,3-dihydro-1H-inden-2-yl)-6-ethylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(2,3-dihydro-1H-inden-2-yl)-6-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66299040 |
| Molecular Formula | C15H16BrN3 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 5-bromo-2-(2,3-dihydro-1H-inden-2-yl)-6-ethylpyrimidin-4-amine |
| SMILES | CCc1nc(C2Cc3ccccc3C2)nc(N)c1Br |
| InChI | InChI=1S/C15H16BrN3/c1-2-12-13(16)14(17)19-15(18-12)11-7-9-5-3-4-6-10(9)8-11/h3-6,11H,2,7-8H2,1H3,(H2,17,18,19) |
| InChIKey | SWZCKFCIDRSJEW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |