C12H12Br2IN3O — CID 66296963
2-(4,5-dibromofuran-2-yl)-N,6-diethyl-5-iodopyrimidin-4-amine (PubChem CID 66296963) has the molecular formula C12H12Br2IN3O and a molecular weight of 500.96 g/mol. Its IUPAC name is 2-(4,5-dibromofuran-2-yl)-N,6-diethyl-5-iodopyrimidin-4-amine.
| Compound Name | 2-(4,5-dibromofuran-2-yl)-N,6-diethyl-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66296963 |
| Molecular Formula | C12H12Br2IN3O |
| Molecular Weight | 500.96 g/mol |
| Exact Mass | 498.84 |
| IUPAC Name | 2-(4,5-dibromofuran-2-yl)-N,6-diethyl-5-iodopyrimidin-4-amine |
| SMILES | CCNc1nc(-c2cc(Br)c(Br)o2)nc(CC)c1I |
| InChI | InChI=1S/C12H12Br2IN3O/c1-3-7-9(15)12(16-4-2)18-11(17-7)8-5-6(13)10(14)19-8/h5H,3-4H2,1-2H3,(H,16,17,18) |
| InChIKey | ZFBBTPPQDBNQGL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.96 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|