C16H24IN3 — CID 66342186
N,N-dicyclohexyl-5-iodopyrimidin-4-amine (PubChem CID 66342186) has the molecular formula C16H24IN3 and a molecular weight of 385.29 g/mol. Its IUPAC name is N,N-dicyclohexyl-5-iodopyrimidin-4-amine.
| Compound Name | N,N-dicyclohexyl-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66342186 |
| Molecular Formula | C16H24IN3 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N,N-dicyclohexyl-5-iodopyrimidin-4-amine |
| SMILES | Ic1cncnc1N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H24IN3/c17-15-11-18-12-19-16(15)20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h11-14H,1-10H2 |
| InChIKey | UKAYHCGEZPCPIE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|