C9H12N4OS — CID 66352311
2-[4-[(thiophen-3-ylamino)methyl]triazol-1-yl]ethanol (PubChem CID 66352311) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is 2-[4-[(thiophen-3-ylamino)methyl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[(thiophen-3-ylamino)methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 66352311 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-[4-[(thiophen-3-ylamino)methyl]triazol-1-yl]ethanol |
| SMILES | OCCn1cc(CNc2ccsc2)nn1 |
| InChI | InChI=1S/C9H12N4OS/c14-3-2-13-6-9(11-12-13)5-10-8-1-4-15-7-8/h1,4,6-7,10,14H,2-3,5H2 |
| InChIKey | BUWATVGCQKBSLX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |