C16H14BrNO3 — CID 66365571
2,3-dihydro-1-benzofuran-2-ylmethyl 3-amino-4-bromobenzoate (PubChem CID 66365571) has the molecular formula C16H14BrNO3 and a molecular weight of 348.20 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-2-ylmethyl 3-amino-4-bromobenzoate.
| Compound Name | 2,3-dihydro-1-benzofuran-2-ylmethyl 3-amino-4-bromobenzoate |
|---|---|
| PubChem CID | 66365571 |
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-2-ylmethyl 3-amino-4-bromobenzoate |
| SMILES | Nc1cc(C(=O)OCC2Cc3ccccc3O2)ccc1Br |
| InChI | InChI=1S/C16H14BrNO3/c17-13-6-5-11(8-14(13)18)16(19)20-9-12-7-10-3-1-2-4-15(10)21-12/h1-6,8,12H,7,9,18H2 |
| InChIKey | ZJDFLFFDWDLLAL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|