C13H13N3O2 — CID 66394111
1-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]triazole-4-carbaldehyde (PubChem CID 66394111) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 1-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]triazole-4-carbaldehyde.
| Compound Name | 1-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 66394111 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]triazole-4-carbaldehyde |
| SMILES | Cc1ccc2c(c1)CC(Cn1cc(C=O)nn1)O2 |
| InChI | InChI=1S/C13H13N3O2/c1-9-2-3-13-10(4-9)5-12(18-13)7-16-6-11(8-17)14-15-16/h2-4,6,8,12H,5,7H2,1H3 |
| InChIKey | MONSBRKNUGLPPA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|