C12H12ClN3O3 — CID 66423555
1-[2-(3-aminophenoxy)ethyl]-5-chloropyrimidine-2,4-dione (PubChem CID 66423555) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is 1-[2-(3-aminophenoxy)ethyl]-5-chloropyrimidine-2,4-dione.
| Compound Name | 1-[2-(3-aminophenoxy)ethyl]-5-chloropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66423555 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 1-[2-(3-aminophenoxy)ethyl]-5-chloropyrimidine-2,4-dione |
| SMILES | Nc1cccc(OCCn2cc(Cl)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C12H12ClN3O3/c13-10-7-16(12(18)15-11(10)17)4-5-19-9-3-1-2-8(14)6-9/h1-3,6-7H,4-5,14H2,(H,15,17,18) |
| InChIKey | KTBADVGUZLGDLH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|