C15H13ClN2O3 — CID 82097982
3-[2-(3-aminophenoxy)ethyl]-5-chloro-1,3-benzoxazol-2-one (PubChem CID 82097982) has the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. Its IUPAC name is 3-[2-(3-aminophenoxy)ethyl]-5-chloro-1,3-benzoxazol-2-one.
| Compound Name | 3-[2-(3-aminophenoxy)ethyl]-5-chloro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82097982 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-[2-(3-aminophenoxy)ethyl]-5-chloro-1,3-benzoxazol-2-one |
| SMILES | Nc1cccc(OCCn2c(=O)oc3ccc(Cl)cc32)c1 |
| InChI | InChI=1S/C15H13ClN2O3/c16-10-4-5-14-13(8-10)18(15(19)21-14)6-7-20-12-3-1-2-11(17)9-12/h1-5,8-9H,6-7,17H2 |
| InChIKey | TWNGOPADNSDVDE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|