C12H17N3 — CID 66467867
3-(2-cyclopropylpyrrolidin-2-yl)pyridin-4-amine (PubChem CID 66467867) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-(2-cyclopropylpyrrolidin-2-yl)pyridin-4-amine.
| Compound Name | 3-(2-cyclopropylpyrrolidin-2-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 66467867 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 3-(2-cyclopropylpyrrolidin-2-yl)pyridin-4-amine |
| SMILES | Nc1ccncc1C1(C2CC2)CCCN1 |
| InChI | InChI=1S/C12H17N3/c13-11-4-7-14-8-10(11)12(9-2-3-9)5-1-6-15-12/h4,7-9,15H,1-3,5-6H2,(H2,13,14) |
| InChIKey | KOFLNBABHRWMFY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |