C18H28N2S — CID 66469414
N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-N-(thiophen-3-ylmethyl)cyclopropanamine (PubChem CID 66469414) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-N-(thiophen-3-ylmethyl)cyclopropanamine.
| Compound Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-N-(thiophen-3-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 66469414 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-ylmethyl)-N-(thiophen-3-ylmethyl)cyclopropanamine |
| SMILES | c1cc(CN(CC2CCC3CCCCC3N2)C2CC2)cs1 |
| InChI | InChI=1S/C18H28N2S/c1-2-4-18-15(3-1)5-6-16(19-18)12-20(17-7-8-17)11-14-9-10-21-13-14/h9-10,13,15-19H,1-8,11-12H2 |
| InChIKey | XHSFAFGNRXRJGA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |