C20H31N — CID 66477249
N-[5,6,7,8-tetrahydronaphthalen-2-yl-(2,2,3,3-tetramethylcyclopropyl)methyl]ethanamine (PubChem CID 66477249) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is N-[5,6,7,8-tetrahydronaphthalen-2-yl-(2,2,3,3-tetramethylcyclopropyl)methyl]ethanamine.
| Compound Name | N-[5,6,7,8-tetrahydronaphthalen-2-yl-(2,2,3,3-tetramethylcyclopropyl)methyl]ethanamine |
|---|---|
| PubChem CID | 66477249 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | N-[5,6,7,8-tetrahydronaphthalen-2-yl-(2,2,3,3-tetramethylcyclopropyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc2c(c1)CCCC2)C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C20H31N/c1-6-21-17(18-19(2,3)20(18,4)5)16-12-11-14-9-7-8-10-15(14)13-16/h11-13,17-18,21H,6-10H2,1-5H3 |
| InChIKey | NGWZPMIRMHBVII-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |