C17H20ClN — CID 66486570
4-[3-(chloromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene (PubChem CID 66486570) has the molecular formula C17H20ClN and a molecular weight of 273.81 g/mol. Its IUPAC name is 4-[3-(chloromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene.
| Compound Name | 4-[3-(chloromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene |
|---|---|
| PubChem CID | 66486570 |
| Molecular Formula | C17H20ClN |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 4-[3-(chloromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene |
| SMILES | ClCc1cccc(N2CC3C4C=CC(CC4)C3C2)c1 |
| InChI | InChI=1S/C17H20ClN/c18-9-12-2-1-3-15(8-12)19-10-16-13-4-5-14(7-6-13)17(16)11-19/h1-5,8,13-14,16-17H,6-7,9-11H2 |
| InChIKey | OXOYESMOBJLPPR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|