methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate

C15H17NO3 — CID 66487519

IUPACmethyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate
SMILESCOC(=O)Cn1cc(C)c(=O)c2cc(C)cc(C)c21
InChIInChI=1S/C15H17NO3/c1-9-5-10(2)14-12(6-9)15(18)11(3)7-16(14)8-13(17)19-4/h5-7H,8H2,1-4H3
InChIKeyGVGSUPZNGKRQII-UHFFFAOYSA-N
MW259.31 g/mol
LogP2.10
Rot. Bonds2

About methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate

methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate (PubChem CID 66487519) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate
PubChem CID66487519
Molecular FormulaC15H17NO3
Molecular Weight259.31 g/mol
Exact Mass259.12
IUPAC Namemethyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate
SMILESCOC(=O)Cn1cc(C)c(=O)c2cc(C)cc(C)c21
InChIInChI=1S/C15H17NO3/c1-9-5-10(2)14-12(6-9)15(18)11(3)7-16(14)8-13(17)19-4/h5-7H,8H2,1-4H3
InChIKeyGVGSUPZNGKRQII-UHFFFAOYSA-N
XLogP2.10
TPSA48.30 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.31
LogP ≤ 52.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate?
The IUPAC name of methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate (CID 66487519) is methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate.
What is the SMILES notation for methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate?
The canonical SMILES for methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate is COC(=O)Cn1cc(C)c(=O)c2cc(C)cc(C)c21.
What is the InChIKey of methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate?
The InChIKey is GVGSUPZNGKRQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3/c1-9-5-10(2)14-12(6-9)15(18)11(3)7-16(14)8-13(17)19-4/h5-7H,8H2,1-4H3.
What are the key properties of methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate?
methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate has a molecular weight of 259.31 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,6,8-trimethyl-4-oxoquinolin-1-yl)acetate is sourced from PubChem (CID 66487519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).