C14H15FN2O — CID 66489345
6-(4-fluorophenyl)-1-methyl-4,5,6,7-tetrahydroindazol-4-ol (PubChem CID 66489345) has the molecular formula C14H15FN2O and a molecular weight of 246.28 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1-methyl-4,5,6,7-tetrahydroindazol-4-ol.
| Compound Name | 6-(4-fluorophenyl)-1-methyl-4,5,6,7-tetrahydroindazol-4-ol |
|---|---|
| PubChem CID | 66489345 |
| Molecular Formula | C14H15FN2O |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 6-(4-fluorophenyl)-1-methyl-4,5,6,7-tetrahydroindazol-4-ol |
| SMILES | Cn1ncc2c1CC(c1ccc(F)cc1)CC2O |
| InChI | InChI=1S/C14H15FN2O/c1-17-13-6-10(7-14(18)12(13)8-16-17)9-2-4-11(15)5-3-9/h2-5,8,10,14,18H,6-7H2,1H3 |
| InChIKey | HJXJJPFRRPXUKR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |