C15H19N3O2 — CID 66489467
6-(2,4-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine (PubChem CID 66489467) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 6-(2,4-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine.
| Compound Name | 6-(2,4-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine |
|---|---|
| PubChem CID | 66489467 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 6-(2,4-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine |
| SMILES | COc1ccc(C2Cc3[nH]ncc3C(N)C2)c(OC)c1 |
| InChI | InChI=1S/C15H19N3O2/c1-19-10-3-4-11(15(7-10)20-2)9-5-13(16)12-8-17-18-14(12)6-9/h3-4,7-9,13H,5-6,16H2,1-2H3,(H,17,18) |
| InChIKey | APDCQNAHPISFBL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |