C20H13Cl2N9 — CID 66499066
N-(3,4-dichlorophenyl)-4-(4-methyl-7-pyridin-3-yl-[1,2,4]triazolo[5,1-c][1,2,4]triazin-3-yl)pyrimidin-2-amine (PubChem CID 66499066) has the molecular formula C20H13Cl2N9 and a molecular weight of 450.29 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-(4-methyl-7-pyridin-3-yl-[1,2,4]triazolo[5,1-c][1,2,4]triazin-3-yl)pyrimidin-2-amine.
| Compound Name | N-(3,4-dichlorophenyl)-4-(4-methyl-7-pyridin-3-yl-[1,2,4]triazolo[5,1-c][1,2,4]triazin-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 66499066 |
| Molecular Formula | C20H13Cl2N9 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-(4-methyl-7-pyridin-3-yl-[1,2,4]triazolo[5,1-c][1,2,4]triazin-3-yl)pyrimidin-2-amine |
| SMILES | Cc1c(-c2ccnc(Nc3ccc(Cl)c(Cl)c3)n2)nnc2nc(-c3cccnc3)nn12 |
| InChI | InChI=1S/C20H13Cl2N9/c1-11-17(28-29-20-27-18(30-31(11)20)12-3-2-7-23-10-12)16-6-8-24-19(26-16)25-13-4-5-14(21)15(22)9-13/h2-10H,1H3,(H,24,25,26) |
| InChIKey | ZYUHFWJJPFGUBA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |