C18H18N6O4 — CID 66503424
methyl 2-[10-(3,4-dimethoxyphenyl)-3-methyl-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate (PubChem CID 66503424) has the molecular formula C18H18N6O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is methyl 2-[10-(3,4-dimethoxyphenyl)-3-methyl-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate.
| Compound Name | methyl 2-[10-(3,4-dimethoxyphenyl)-3-methyl-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
|---|---|
| PubChem CID | 66503424 |
| Molecular Formula | C18H18N6O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | methyl 2-[10-(3,4-dimethoxyphenyl)-3-methyl-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
| SMILES | COC(=O)Cc1nn(C)c2c1nnc1c(-c3ccc(OC)c(OC)c3)cnn12 |
| InChI | InChI=1S/C18H18N6O4/c1-23-18-16(12(22-23)8-15(25)28-4)20-21-17-11(9-19-24(17)18)10-5-6-13(26-2)14(7-10)27-3/h5-7,9H,8H2,1-4H3 |
| InChIKey | ZIPQEJAXEFVMAO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |