C21H15FN6O2 — CID 66502993
methyl 2-[10-(4-fluorophenyl)-3-phenyl-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate (PubChem CID 66502993) has the molecular formula C21H15FN6O2 and a molecular weight of 402.39 g/mol. Its IUPAC name is methyl 2-[10-(4-fluorophenyl)-3-phenyl-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate.
| Compound Name | methyl 2-[10-(4-fluorophenyl)-3-phenyl-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
|---|---|
| PubChem CID | 66502993 |
| Molecular Formula | C21H15FN6O2 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | methyl 2-[10-(4-fluorophenyl)-3-phenyl-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
| SMILES | COC(=O)Cc1nn(-c2ccccc2)c2c1nnc1c(-c3ccc(F)cc3)cnn12 |
| InChI | InChI=1S/C21H15FN6O2/c1-30-18(29)11-17-19-21(27(26-17)15-5-3-2-4-6-15)28-20(25-24-19)16(12-23-28)13-7-9-14(22)10-8-13/h2-10,12H,11H2,1H3 |
| InChIKey | GTJNWGMRLQYYSV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |