C23H18Cl2N6O2 — CID 66503261
methyl 2-[3,10-bis(4-chlorophenyl)-11-ethyl-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate (PubChem CID 66503261) has the molecular formula C23H18Cl2N6O2 and a molecular weight of 481.34 g/mol. Its IUPAC name is methyl 2-[3,10-bis(4-chlorophenyl)-11-ethyl-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate.
| Compound Name | methyl 2-[3,10-bis(4-chlorophenyl)-11-ethyl-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
|---|---|
| PubChem CID | 66503261 |
| Molecular Formula | C23H18Cl2N6O2 |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | methyl 2-[3,10-bis(4-chlorophenyl)-11-ethyl-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
| SMILES | CCc1nn2c(nnc3c(CC(=O)OC)nn(-c4ccc(Cl)cc4)c32)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18Cl2N6O2/c1-3-17-20(13-4-6-14(24)7-5-13)22-27-26-21-18(12-19(32)33-2)29-30(23(21)31(22)28-17)16-10-8-15(25)9-11-16/h4-11H,3,12H2,1-2H3 |
| InChIKey | JYDDGUIKMQULJP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |