C16H15N7O3 — CID 66502542
methyl 2-[3-(4-methoxyphenyl)-11-methyl-1,3,4,7,8,10,12-heptazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate (PubChem CID 66502542) has the molecular formula C16H15N7O3 and a molecular weight of 353.34 g/mol. Its IUPAC name is methyl 2-[3-(4-methoxyphenyl)-11-methyl-1,3,4,7,8,10,12-heptazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate.
| Compound Name | methyl 2-[3-(4-methoxyphenyl)-11-methyl-1,3,4,7,8,10,12-heptazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
|---|---|
| PubChem CID | 66502542 |
| Molecular Formula | C16H15N7O3 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | methyl 2-[3-(4-methoxyphenyl)-11-methyl-1,3,4,7,8,10,12-heptazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
| SMILES | COC(=O)Cc1nn(-c2ccc(OC)cc2)c2c1nnc1nc(C)nn12 |
| InChI | InChI=1S/C16H15N7O3/c1-9-17-16-19-18-14-12(8-13(24)26-3)21-22(15(14)23(16)20-9)10-4-6-11(25-2)7-5-10/h4-7H,8H2,1-3H3 |
| InChIKey | YRSKLBKPWAODBL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 109.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |