C16H14N6O3 — CID 66502557
methyl 2-[3-(4-methoxyphenyl)-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate (PubChem CID 66502557) has the molecular formula C16H14N6O3 and a molecular weight of 338.33 g/mol. Its IUPAC name is methyl 2-[3-(4-methoxyphenyl)-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate.
| Compound Name | methyl 2-[3-(4-methoxyphenyl)-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
|---|---|
| PubChem CID | 66502557 |
| Molecular Formula | C16H14N6O3 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | methyl 2-[3-(4-methoxyphenyl)-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
| SMILES | COC(=O)Cc1nn(-c2ccc(OC)cc2)c2c1nnc1ccnn12 |
| InChI | InChI=1S/C16H14N6O3/c1-24-11-5-3-10(4-6-11)21-16-15(12(20-21)9-14(23)25-2)19-18-13-7-8-17-22(13)16/h3-8H,9H2,1-2H3 |
| InChIKey | IHQYQRTYHBHLCJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 96.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |